For research use only. Not for therapeutic Use.
Genkwanin(Cat No.:R020766)is a naturally occurring flavonoid found in plants like Daphne genkwa and Alpinia katsumadai, known for its anti-inflammatory, antioxidant, and anticancer properties. This compound has shown potential in modulating inflammatory pathways, reducing oxidative stress, and inducing apoptosis in cancer cells, making it of interest in pharmacological and nutraceutical research. Additionally, genkwanin has been studied for its antimicrobial effects, contributing to its therapeutic versatility. Its diverse bioactivities support ongoing studies to explore its applications in treating conditions linked to inflammation, oxidative damage, and microbial infections.
CAS Number | 437-64-9 |
Synonyms | 4’,5-Dihydroxy-7-methoxyflavone; 7-Methylapigenin; 7-O-Methylapigenin; Apigenin 7-O-Methyl Ether; Apigenin 7-Methyl Ether; Puddumetin; |
Molecular Formula | C16H12O5 |
Purity | ≥95% |
Target | Virus Protease |
Storage | -20°C |
IUPAC Name | 5-hydroxy-2-(4-hydroxyphenyl)-7-methoxychromen-4-one |
InChI | InChI=1S/C16H12O5/c1-20-11-6-12(18)16-13(19)8-14(21-15(16)7-11)9-2-4-10(17)5-3-9/h2-8,17-18H,1H3 |
InChIKey | JPMYFOBNRRGFNO-UHFFFAOYSA-N |
SMILES | COC1=CC(=C2C(=C1)OC(=CC2=O)C3=CC=C(C=C3)O)O |