For research use only. Not for therapeutic Use.
Gentamicin (Cat No.:M046866) is a potent and broad-spectrum antibiotic belonging to the aminoglycoside class. Produced through bacterial fermentation, it effectively targets both Gram-negative and certain Gram-positive bacteria by inhibiting protein synthesis, leading to bacterial cell death. This versatile antibiotic is extensively used in the treatment of severe bacterial infections, especially those caused by drug-resistant strains. Gentamicin is available in various formulations, enabling its administration through different routes, making it a crucial therapeutic agent in combating a wide range of life-threatening bacterial infections.
CAS Number | 1403-66-3 |
Molecular Formula | C21H43N5O7 |
Purity | ≥95% |
Target | Antibiotic |
Storage | -20°C |
IUPAC Name | 2-[4,6-diamino-3-[3-amino-6-[1-(methylamino)ethyl]oxan-2-yl]oxy-2-hydroxycyclohexyl]oxy-5-methyl-4-(methylamino)oxane-3,5-diol |
InChI | InChI=1S/C21H43N5O7/c1-9(25-3)13-6-5-10(22)19(31-13)32-16-11(23)7-12(24)17(14(16)27)33-20-15(28)18(26-4)21(2,29)8-30-20/h9-20,25-29H,5-8,22-24H2,1-4H3 |
InChIKey | CEAZRRDELHUEMR-UHFFFAOYSA-N |
SMILES | CC(C1CCC(C(O1)OC2C(CC(C(C2O)OC3C(C(C(CO3)(C)O)NC)O)N)N)N)NC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |