For research use only. Not for therapeutic Use.
Gentiopicroside(Cat No.:R024394) is a natural compound known as a secoiridoid glycoside. Its mode of action involves being derived from certain plant sources, including the gentian root (Gentiana species). Gentiopicroside has been studied for its potential pharmacological properties, including its bitterness and its role in stimulating appetite and aiding digestion. Additionally, it exhibits potential anti-inflammatory, antioxidant, and hepatoprotective effects. Due to its various bioactivities, gentiopicroside is of interest in traditional medicine and herbal remedies.
CAS Number | 20831-76-9 |
Synonyms | (5R-trans)-5-Ethenyl-6-(β-D-glucopyranosyloxy)-5,6-dihydro-1H,3H-Pyrano[3,4-c]pyran-1-one; Gentiopicrin; Gentiopicroside; NSC 606402 |
Molecular Formula | C16H20O9 |
Purity | ≥95% |
Target | Anti-infection |
Storage | Store at -20C |
IUPAC Name | (3S,4R)-4-ethenyl-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4,6-dihydro-3H-pyrano[3,4-c]pyran-8-one |
InChI | InChI=1S/C16H20O9/c1-2-7-8-3-4-22-14(21)9(8)6-23-15(7)25-16-13(20)12(19)11(18)10(5-17)24-16/h2-3,6-7,10-13,15-20H,1,4-5H2/t7-,10-,11-,12+,13-,15+,16+/m1/s1 |
InChIKey | DUAGQYUORDTXOR-GPQRQXLASA-N |
SMILES | C=C[C@H]1[C@@H](OC=C2C1=CCOC2=O)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O |