For research use only. Not for therapeutic Use.
Genz-644282(Cat No.:I003934)is an investigational anticancer compound developed for its potential in treating various types of cancer. It belongs to the class of DNA topoisomerase I inhibitors, which work by stabilizing the DNA-topoisomerase complex, leading to DNA damage and cell death in rapidly dividing cancer cells. Genz-644282 has shown promising preclinical results, particularly in models of solid tumors, making it a candidate for further development in oncology. Its unique mechanism of action and potent cytotoxicity highlight its potential as a novel therapeutic agent in cancer treatment.
CAS Number | 529488-28-6 |
Synonyms | Genz-644282; Genz644282;2,3-dimethoxy-12-(2-(methylamino)ethyl)-[1,3]dioxolo[4/’,5/’:4,5]benzo[1,2-h]benzo[c][1,6]naphthyridin-13(12H)-one |
Molecular Formula | C22H21N3O5 |
Purity | ≥95% |
Target | Topoisomerase |
IUPAC Name | 16,17-dimethoxy-21-[2-(methylamino)ethyl]-5,7-dioxa-11,21-diazapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(13),2,4(8),9,11,14,16,18-octaen-20-one |
InChI | InChI=1S/C22H21N3O5/c1-23-4-5-25-21-14-8-19-20(30-11-29-19)9-16(14)24-10-15(21)12-6-17(27-2)18(28-3)7-13(12)22(25)26/h6-10,23H,4-5,11H2,1-3H3 |
InChIKey | BAORCAMWLWRZQG-UHFFFAOYSA-N |
SMILES | CNCCN1C2=C(C=NC3=CC4=C(C=C32)OCO4)C5=CC(=C(C=C5C1=O)OC)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |