For research use only. Not for therapeutic Use.
Germacrene D(Cat No.:R029316)is a natural sesquiterpene commonly found in essential oils of plants such as Cymbopogon (lemongrass) and Cannabis sativa. Known for its woody and earthy aroma, it contributes to the therapeutic effects of essential oils with antioxidant, anti-inflammatory, and antimicrobial properties. Germacrene D is studied for its potential to inhibit tumor growth, repel insects, and combat pathogens, making it valuable in both medicinal and agricultural research. Its bioactive properties and natural occurrence support its use in holistic health applications and plant-based therapeutic formulations.
CAS Number | 23986-74-5 |
Synonyms | [S-(E,E)]-1-Methyl-5-methylene-8-(1-methylethyl)-1,6-cyclodecadiene;?(-)-Germacra-1(10),4(15),5-triene; (-)-Germacrene D; Germacrene D;?[s-(E,E)]-1-Methyl-5-methylene-8-(1-methylethyl)-1,6-cyclodecyldidiene; |
Molecular Formula | C15H24 |
Purity | ≥95% |
Documentation | |
Target | Bacterial |
Storage | -20°C |
IUPAC Name | (1E,6E,8S)-1-methyl-5-methylidene-8-propan-2-ylcyclodeca-1,6-diene |
InChI | InChI=1S/C15H24/c1-12(2)15-10-8-13(3)6-5-7-14(4)9-11-15/h7-8,10,12,15H,3,5-6,9,11H2,1-2,4H3/b10-8+,14-7+/t15-/m0/s1 |
InChIKey | GAIBLDCXCZKKJE-RXJOXMPGSA-N |
SMILES | C/C/1=C\CCC(=C)/C=C/[C@@H](CC1)C(C)C |