For research use only. Not for therapeutic Use.
Germacrone（Cat No.:R024197）is a natural sesquiterpene commonly found in the essential oils of various medicinal plants, particularly turmeric (Curcuma spp.). Known for its anti-inflammatory, anticancer, and antiviral properties, germacrone has attracted attention in pharmacological research. It inhibits tumor growth, induces apoptosis, and has shown promise in inhibiting certain viral replications. Germacrone’s ability to modulate inflammatory responses and its antioxidant effects add to its therapeutic potential, making it a valuable compound in traditional and modern medicine. It is being explored for its application in cancer therapy and immune system support.
| Catalog Number | R024197 |
| CAS Number | 6902-91-6 |
| Synonyms | (3E,7E)-3,7-Dimethyl-10-(1-methylethylidene)-3,7-Cyclodecadien-1-one; ?(E,E)-Germacra-3,7(11),9-trien-6-one; Germacrone; (E,E)-Germacrone; |
| Molecular Formula | C15H22O |
| Purity | ≥95% |
| Target | Influenza Virus |
| Storage | -20°C |
| IUPAC Name | (3E,7E)-3,7-dimethyl-10-propan-2-ylidenecyclodeca-3,7-dien-1-one |
| InChI | InChI=1S/C15H22O/c1-11(2)14-9-8-12(3)6-5-7-13(4)10-15(14)16/h7-8H,5-6,9-10H2,1-4H3/b12-8+,13-7+ |
| InChIKey | CAULGCQHVOVVRN-SWZPTJTJSA-N |
| SMILES | C/C/1=C\CC(=C(C)C)C(=O)C/C(=C/CC1)/C |
| Reference | Liu, Y., Zheng, Q., Fang, B., Wang, W., Ma, F., Roshan, S., . . . He, G. (2013). Germacrone induces apoptosis in human hepatoma HepG2 cells through inhibition of the JAK2/STAT3 signalling pathway. <em>Journal of Huazhong University of Science and Technology</em>, 33(3), 339-345. doi:10.1007/s11596-013-1121-z<br/><br/> |
