For research use only. Not for therapeutic Use.
Germanicol is a triterpene alcohol commonly found in plants like Boswellia serrata and Callicarpa japonica. This natural compound exhibits various pharmacological properties, including anti-inflammatory and analgesic effects. Germanicol has been used in traditional medicine for its potential therapeutic benefits in treating conditions such as arthritis and inflammatory disorders. Research suggests that Germanicol may also possess antimicrobial properties, further expanding its potential applications. Ongoing studies aim to elucidate its mechanisms of action and explore its efficacy and safety profiles, with potential implications for modern medicine.
CAS Number | 465-02-1 |
Molecular Formula | C30H50O |
Purity | ≥95% |
Target | Apoptosis |
Storage | -20°C |
IUPAC Name | (3S,4aR,6aS,6aR,6bR,8aR,14aR,14bR)-4,4,6a,6b,8a,11,11,14b-octamethyl-1,2,3,4a,5,6,6a,7,8,9,10,13,14,14a-tetradecahydropicen-3-ol |
InChI | InChI=1S/C30H50O/c1-25(2)15-16-27(5)17-18-29(7)20(21(27)19-25)9-10-23-28(6)13-12-24(31)26(3,4)22(28)11-14-30(23,29)8/h19-20,22-24,31H,9-18H2,1-8H3/t20-,22+,23-,24+,27-,28+,29-,30-/m1/s1 |
InChIKey | QMUXVPRGNJLGRT-PNTWTTAKSA-N |
SMILES | CC1(CCC2(CCC3(C(C2=C1)CCC4C3(CCC5C4(CCC(C5(C)C)O)C)C)C)C)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |