For research use only. Not for therapeutic Use.
GFB-12811（Cat No.:I043897）is a small molecule compound that functions as an inhibitor targeting specific enzymes or proteins involved in cellular signaling pathways. It is being researched for its potential therapeutic applications in diseases like cancer, autoimmune disorders, or inflammation. By modulating key proteins, GFB-12811 may help regulate cellular processes such as proliferation, apoptosis, and immune response. Early studies suggest that it could have significant therapeutic benefits by inhibiting abnormal cellular activity associated with disease progression.
| CAS Number | 2775311-17-4 |
| Synonyms | (1R)-1-[7-[[5-fluoro-2-(trifluoromethyl)pyridin-4-yl]amino]-1,6-naphthyridin-2-yl]-1-(1-methylpiperidin-4-yl)ethanol |
| Molecular Formula | C22H23F4N5O |
| Purity | ≥95% |
| IUPAC Name | (1R)-1-[7-[[5-fluoro-2-(trifluoromethyl)pyridin-4-yl]amino]-1,6-naphthyridin-2-yl]-1-(1-methylpiperidin-4-yl)ethanol |
| InChI | InChI=1S/C22H23F4N5O/c1-21(32,14-5-7-31(2)8-6-14)18-4-3-13-11-28-20(10-16(13)29-18)30-17-9-19(22(24,25)26)27-12-15(17)23/h3-4,9-12,14,32H,5-8H2,1-2H3,(H,27,28,30)/t21-/m1/s1 |
| InChIKey | GHNYLVIESIGHDJ-OAQYLSRUSA-N |
| SMILES | C[C@@](C1CCN(CC1)C)(C2=NC3=CC(=NC=C3C=C2)NC4=CC(=NC=C4F)C(F)(F)F)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
