For research use only. Not for therapeutic Use.
GHRP-5 TFA salt (Growth Hormone Releasing Peptide-5 trifluoroacetate salt) is a synthetic peptide that stimulates the secretion of growth hormone (GH) from the pituitary gland. It is part of the GHRP family, which mimics ghrelin, a natural hormone that activates the growth hormone secretagogue receptor (GHS-R). GHRP-5 is studied for its potential role in enhancing muscle growth, fat metabolism, and overall anabolic processes. The trifluoroacetate (TFA) salt form is commonly used to stabilize the peptide. Due to its effects on GH release, GHRP-5 is of interest in research on growth disorders, anti-aging, and metabolic conditions.
CAS Number | 76338-80-2 |
Synonyms | GHRP-5 TFA Salt; N-[N-[N-(N-L-Tyrosyl-D-tryptophyl)-L-alanyl]-L-tryptophyl]-D-phenylalanine TFA Salt; Growth Hormone Releasing Peptide 5 TFA Salt; |
Molecular Formula | C₄₃H₄₅N₇O₇ •xC₂HF₃O₂ |
Purity | ≥95% |
InChI | InChI=1S/C43H45N7O7/c1-25(47-41(54)36(21-28-23-45-34-13-7-5-11-31(28)34)49-40(53)33(44)19-27-15-17-30(51)18-16-27)39(52)48-37(22-29-24-46-35-14-8-6-12-32(29)35)42(55)50-38(43(56)57)20-26-9-3-2-4-10-26/h2-18,23-25,33,36-38,45-46,51H,19-22,44H2,1H3,(H,47,54)(H,48,52)(H,49,53)(H,50,55)(H,56,57)/t25-,33-,36+,37-,38?/m0/s1 |
InChIKey | LQEXLGBRTXRQNP-SFXFQBHDSA-N |
SMILES | C[C@@H](C(=O)N[C@@H](CC1=CNC2=CC=CC=C21)C(=O)NC(CC3=CC=CC=C3)C(=O)O)NC(=O)[C@@H](CC4=CNC5=CC=CC=C54)NC(=O)[C@H](CC6=CC=C(C=C6)O)N |