For research use only. Not for therapeutic Use.
Gigantol（Cat No.:I041263）is a natural polyphenolic compound found in certain plants, particularly in the genus Dendrobium, a type of orchid. It is known for its antioxidant and anti-inflammatory properties, which may offer therapeutic potential in treating conditions related to oxidative stress and inflammation. Gigantol has been studied for its potential to protect against neurodegenerative diseases, such as Alzheimer’s, by reducing oxidative damage in the brain. Additionally, its antimicrobial and anticancer activities have been explored in scientific research. Gigantol’s promising bioactivity makes it a candidate for further pharmacological studies and potential drug development.
| CAS Number | 83088-28-2 |
| Synonyms | 4-[2-(3-hydroxy-5-methoxyphenyl)ethyl]-2-methoxyphenol |
| Molecular Formula | C16H18O4 |
| Purity | ≥95% |
| IUPAC Name | 4-[2-(3-hydroxy-5-methoxyphenyl)ethyl]-2-methoxyphenol |
| InChI | InChI=1S/C16H18O4/c1-19-14-8-12(7-13(17)10-14)4-3-11-5-6-15(18)16(9-11)20-2/h5-10,17-18H,3-4H2,1-2H3 |
| InChIKey | BMSPEISBKGSBTR-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1)O)CCC2=CC(=C(C=C2)O)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
