For research use only. Not for therapeutic Use.
Ginkgetin (CAT: I003693) is a natural flavonoid compound derived from Ginkgo biloba leaves. It possesses various pharmacological activities and has been studied for its potential therapeutic applications. Ginkgetin exhibits antioxidant properties, helping to reduce oxidative stress and protect cells from damage. It also shows anti-inflammatory effects by inhibiting the production of pro-inflammatory molecules. Additionally, ginkgetin has been investigated for its anticancer activity, demonstrating the ability to inhibit cancer cell proliferation, induce apoptosis, and inhibit tumor growth in preclinical studies. Furthermore, ginkgetin has been explored for its neuroprotective effects and potential benefits in the treatment of neurodegenerative disorders.
| Catalog Number | I003693 |
| CAS Number | 481-46-9 |
| Molecular Formula | C32H22O10 |
| Purity | ≥95% |
| Solubility | 10 mM in DMSO |
| Storage | -20 ℃ |
| IUPAC Name | 5,7-dihydroxy-8-[5-(5-hydroxy-7-methoxy-4-oxochromen-2-yl)-2-methoxyphenyl]-2-(4-hydroxyphenyl)chromen-4-one |
| InChI | 1S/C32H22O10/c1-39-18-10-20(34)30-23(37)13-27(41-28(30)11-18)16-5-8-25(40-2)19(9-16)29-21(35)12-22(36)31-24(38)14-26(42-32(29)31)15-3-6-17(33)7-4-15/h3-14,33-36H,1-2H3 |
| InChIKey | AIFCFBUSLAEIBR-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=CC(=O)C3=C(C=C(C=C3O2)OC)O)C4=C(C=C(C5=C4OC(=CC5=O)C6=CC=C(C=C6)O)O)O |
