For research use only. Not for therapeutic Use.
Ginkgolide B (Cat.No:I001907) is a bioactive compound extracted from Ginkgo biloba leaves. It belongs to the family of terpenes and has been extensively researched for its pharmacological properties. Ginkgolide B exhibits potent antiplatelet and neuroprotective effects, making it a potential candidate for the treatment of cardiovascular diseases and neurological disorders.
CAS Number | 15291-77-7 |
Synonyms | BN 52021;BN 52051 |
Molecular Formula | C20H24O10 |
Purity | ≥95% |
Target | Apoptosis |
Solubility | DMSO: ≥ 30 mg/mL |
Storage | -20℃ |
IUPAC Name | 8-tert-butyl-6,12,17-trihydroxy-16-methyl-2,4,14,19-tetraoxahexacyclo[8.7.2.01,11.03,7.07,11.013,17]nonadecane-5,15,18-trione |
InChI | InChI=1S/C20H24O10/c1-6-12(23)28-11-9(21)18-8-5-7(16(2,3)4)17(18)10(22)13(24)29-15(17)30-20(18,14(25)27-8)19(6,11)26/h6-11,15,21-22,26H,5H2,1-4H3 |
InChIKey | SQOJOAFXDQDRGF-RZXAINQJSA-N |
SMILES | CC1C(=O)OC2C1(C34C(=O)OC5C3(C2O)C6(C(C5)C(C)(C)C)C(C(=O)OC6O4)O)O |