For research use only. Not for therapeutic Use.
GinsenosideRg6（Cat No.:I001802） is a natural compound obtained from the roots of Panax notoginseng. It exhibits a range of biological activities, including the ability to inhibit the transcriptional activity of the nuclear factor kappa B (NF-κB) pathway induced by TNF-αChemicalbook in HepG2 cells, with an IC50 value of 29.34±2.22μM. Additionally, GinsenosideRg6 has been shown to induce apoptosis in various cell lines.
| Catalog Number | I001802 |
| CAS Number | 147419-93-0 |
| Molecular Formula | C42H70O12 |
| Purity | ≥95% |
| Target | Apoptosis |
| Solubility | 10 mM in DMSO |
| Storage | Store at -20°C |
| IUPAC Name | (2S,3R,4R,5R,6S)-2-[(2R,3R,4S,5S,6R)-2-[[(3S,5R,6S,8R,9R,10R,12R,13R,14R,17S)-3,12-dihydroxy-4,4,8,10,14-pentamethyl-17-(6-methylhepta-1,5-dien-2-yl)-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-6-yl]oxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]oxy-6-methyloxane-3,4,5-triol |
| InChI | InChI=1S/C42H70O12/c1-20(2)11-10-12-21(3)23-13-16-41(8)29(23)24(44)17-27-40(7)15-14-28(45)39(5,6)36(40)25(18-42(27,41)9)52-38-35(33(49)31(47)26(19-43)53-38)54-37-34(50)32(48)30(46)22(4)51-37/h11,22-38,43-50H,3,10,12-19H2,1-2,4-9H3/t22-,23+,24+,25-,26+,27+,28-,29-,30-,31+,32+,33-,34+,35+,36-,37-,38+,40+,41+,42+/m0/s1 |
| InChIKey | ZVTVWDXRNMHGNY-JOGTXEPTSA-N |
| SMILES | CC1C(C(C(C(O1)OC2C(C(C(OC2OC3CC4(C(CC(C5C4(CCC5C(=C)CCC=C(C)C)C)O)C6(C3C(C(CC6)O)(C)C)C)C)CO)O)O)O)O)O |
| Reference | <p style=/line-height:25px/> </p> |
