For research use only. Not for therapeutic Use.
Girard’s Reagent T (Cat No.:R062000) is a chemical compound commonly used in analytical chemistry for the derivatization of aldehydes and ketones. It reacts with carbonyl compounds to form stable, colorless derivatives that are easily detectable by chromatographic methods such as HPLC or GC. This reagent is widely utilized for the determination of carbonyl-containing compounds in complex mixtures, such as in pharmaceutical and environmental analysis. Girard’s Reagent T also aids in the separation and identification of small carbonyl molecules, providing enhanced sensitivity and selectivity in quantitative assays.
CAS Number | 123-46-6 |
Synonyms | (2-hydrazinyl-2-oxoethyl)-trimethylazanium;chloride |
Molecular Formula | C5H14ClN3O |
Purity | ≥95% |
IUPAC Name | (2-hydrazinyl-2-oxoethyl)-trimethylazanium;chloride |
InChI | InChI=1S/C5H13N3O.ClH/c1-8(2,3)4-5(9)7-6;/h4,6H2,1-3H3;1H |
InChIKey | YSULOORXQBDPCU-UHFFFAOYSA-N |
SMILES | C[N+](C)(C)CC(=O)NN.[Cl-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |