For research use only. Not for therapeutic Use.
Giripladib（Cat No.:R030065）is a potent inhibitor of secretory phospholipase A2 (sPLA2), an enzyme involved in inflammatory processes. By inhibiting sPLA2, Giripladib helps reduce the production of pro-inflammatory mediators, making it a promising candidate for treating inflammatory diseases such as arthritis, asthma, and atherosclerosis. Its targeted action provides an advantage in minimizing systemic side effects typically associated with broad-spectrum anti-inflammatory drugs. Ongoing research explores Giripladib’s therapeutic potential and efficacy in various clinical settings, aiming to develop novel treatments that address chronic inflammation with improved safety profiles.
| Catalog Number | R030065 |
| CAS Number | 865200-20-0 |
| Synonyms | 4-[3-[1-benzhydryl-5-chloro-2-[2-[[2-(trifluoromethyl)phenyl]methylsulfonylamino]ethyl]indol-3-yl]propyl]benzoic acid |
| Molecular Formula | C41H36ClF3N2O4S |
| Purity | ≥95% |
| IUPAC Name | 4-[3-[1-benzhydryl-5-chloro-2-[2-[[2-(trifluoromethyl)phenyl]methylsulfonylamino]ethyl]indol-3-yl]propyl]benzoic acid |
| InChI | InChI=1S/C41H36ClF3N2O4S/c42-33-22-23-37-35(26-33)34(16-9-10-28-18-20-31(21-19-28)40(48)49)38(47(37)39(29-11-3-1-4-12-29)30-13-5-2-6-14-30)24-25-46-52(50,51)27-32-15-7-8-17-36(32)41(43,44)45/h1-8,11-15,17-23,26,39,46H,9-10,16,24-25,27H2,(H,48,49) |
| InChIKey | NHHBNHIPCSPSHQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)N3C4=C(C=C(C=C4)Cl)C(=C3CCNS(=O)(=O)CC5=CC=CC=C5C(F)(F)F)CCCC6=CC=C(C=C6)C(=O)O |
