For research use only. Not for therapeutic Use.
GK13S（Cat No.:I041218）is a selective small molecule inhibitor of the protein kinase GSK-3β (glycogen synthase kinase 3 beta), a key enzyme involved in regulating various cellular processes such as metabolism, cell survival, and gene expression. By inhibiting GSK-3β, GK13S has shown potential in modulating signaling pathways associated with neurodegenerative diseases like Alzheimer’s, Parkinson’s, and bipolar disorder. It may also have applications in cancer therapy, as GSK-3β dysregulation is linked to tumor progression. Research is ongoing to explore GK13S’s pharmacological profile and its therapeutic potential in treating these conditions.
| Synonyms | (3S)-1-cyano-N-[1-[4-(pent-4-ynylcarbamoyl)phenyl]imidazol-4-yl]pyrrolidine-3-carboxamide |
| Molecular Formula | C21H22N6O2 |
| Purity | ≥95% |
| IUPAC Name | (3S)-1-cyano-N-[1-[4-(pent-4-ynylcarbamoyl)phenyl]imidazol-4-yl]pyrrolidine-3-carboxamide |
| InChI | InChI=1S/C21H22N6O2/c1-2-3-4-10-23-20(28)16-5-7-18(8-6-16)27-13-19(24-15-27)25-21(29)17-9-11-26(12-17)14-22/h1,5-8,13,15,17H,3-4,9-12H2,(H,23,28)(H,25,29)/t17-/m0/s1 |
| InChIKey | LSHAYFDZIOIKII-KRWDZBQOSA-N |
| SMILES | C#CCCCNC(=O)C1=CC=C(C=C1)N2C=C(N=C2)NC(=O)[C@H]3CCN(C3)C#N |
