For research use only. Not for therapeutic Use.
GK187(CAT: I012616) is a small-molecule compound known for its role as a potent and selective inhibitor of glycogen synthase kinase-3 (GSK-3), a key enzyme involved in various cellular processes, including glycogen metabolism, cell signaling, and neuroprotection. By inhibiting GSK-3, GK187 has potential applications in neurological and metabolic research, particularly for studying diseases like Alzheimer’s, bipolar disorder, diabetes, and cancer, where dysregulated GSK-3 activity plays a role. Its specificity and potency make GK187 a valuable tool for exploring therapeutic strategies targeting GSK-3-related pathways in diverse pathological conditions.
| Catalog Number | I012616 |
| CAS Number | 1071001-50-7 |
| Synonyms | 1,1,1,2,2-Pentafluoro-7-(4-methoxyphenyl)heptan-3-one |
| Molecular Formula | C14H15F5O2 |
| Purity | ≥95% |
| Target | Phospholipase |
| IUPAC Name | 1,1,1,2,2-pentafluoro-7-(4-methoxyphenyl)heptan-3-one |
| InChI | InChI=1S/C14H15F5O2/c1-21-11-8-6-10(7-9-11)4-2-3-5-12(20)13(15,16)14(17,18)19/h6-9H,2-5H2,1H3 |
| InChIKey | CICDFDPOGZQTQB-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CCCCC(=O)C(C(F)(F)F)(F)F |
