For research use only. Not for therapeutic Use.
GK921(CAT: I000163) is a potent transglutaminase 2 (TGase 2) inhibitor, widely used in cancer research. It exhibits an average GI50 of 0.9 µM across various cancer cell lines, demonstrating significant anticancer activity. By targeting TGase 2, a multifunctional enzyme implicated in tumor progression, drug resistance, and metastasis, GK921 disrupts key cellular processes, making it a valuable tool for exploring therapeutic strategies in oncology. With high purity and stability, it is ideal for in vitro studies and preclinical research, supporting advancements in understanding TGase 2-related mechanisms and the development of novel cancer treatments.
| Catalog Number | I000163 |
| CAS Number | 1025015-40-0 |
| Molecular Formula | C21H20N4O |
| Purity | ≥95% |
| Target | Glutaminase |
| Solubility | DMSO: ≥ 37 mg/mL |
| Storage | 3 years -20C powder |
| IC50 | 0.9 uM (GI50) [1] |
| IUPAC Name | 3-(2-phenylethynyl)-2-(2-pyrrolidin-1-ylethoxy)pyrido[2,3-b]pyrazine |
| InChI | InChI=1S/C21H20N4O/c1-2-7-17(8-3-1)10-11-19-21(26-16-15-25-13-4-5-14-25)24-18-9-6-12-22-20(18)23-19/h1-3,6-9,12H,4-5,13-16H2 |
| InChIKey | MNYJJHBAEYKXEG-UHFFFAOYSA-N |
| SMILES | C12=NC=CC=C1N=C(OCCN3CCCC3)C(C#CC4=CC=CC=C4)=N2 |
