For research use only. Not for therapeutic Use.
Glabranin(CAT: R028953) is a chemical compound derived from licorice (Glycyrrhiza glabra) root extract. Its mode of action and pharmacological effects can involve interactions with cellular receptors and biochemical pathways due to its specific chemical structure. Glabranin has been investigated for its potential bioactivities, including anti-inflammatory, antioxidant, and antiviral properties. It also exhibits potential in skin-lightening and anti-aging applications. Its applications extend to cosmetics and skincare products, where it is used for its potential to promote healthy skin and provide various dermatological benefits.
| Catalog Number | R028953 |
| CAS Number | 41983-91-9 |
| Molecular Formula | C20H20O4 |
| Purity | ≥95% |
| IUPAC Name | (2S)-5,7-dihydroxy-8-(3-methylbut-2-enyl)-2-phenyl-2,3-dihydrochromen-4-one |
| InChI | InChI=1S/C20H20O4/c1-12(2)8-9-14-15(21)10-16(22)19-17(23)11-18(24-20(14)19)13-6-4-3-5-7-13/h3-8,10,18,21-22H,9,11H2,1-2H3/t18-/m0/s1 |
| InChIKey | DAWSYIQAGQMLFS-SFHVURJKSA-N |
| SMILES | CC(=CCC1=C(C=C(C2=C1OC(CC2=O)C3=CC=CC=C3)O)O)C |
