For research use only. Not for therapeutic Use.
Glabrene is a high-purity natural compound used in pharmaceutical and biochemical research. This isoflavonoid, derived from licorice root, is essential for studying its estrogenic and antioxidant properties. Its precise composition ensures reliable and reproducible results, making it indispensable for drug development and natural product research. Ideal for experimental setups, Glabrene enhances research accuracy and efficacy in various scientific investigations.
Catalog Number | R024410 |
CAS Number | 60008-03-9 |
Molecular Formula | C20H18O4 |
Purity | ≥95% |
Target | Tyrosinase |
IUPAC Name | 8-(7-hydroxy-2H-chromen-3-yl)-2,2-dimethylchromen-5-ol |
InChI | InChI=1S/C20H18O4/c1-20(2)8-7-16-17(22)6-5-15(19(16)24-20)13-9-12-3-4-14(21)10-18(12)23-11-13/h3-10,21-22H,11H2,1-2H3 |
InChIKey | NGGYSPUAKQMTNP-UHFFFAOYSA-N |
SMILES | CC1(C=CC2=C(C=CC(=C2O1)C3=CC4=C(C=C(C=C4)O)OC3)O)C |