For research use only, not for therapeutic use.
Glabridin（Cat No.:R015032）is a bioactive flavonoid extracted from licorice root (Glycyrrhiza glabra), known for its various health benefits. It possesses antioxidant, anti-inflammatory, and antimicrobial properties, making it a popular ingredient in skincare products and dietary supplements. Glabridin has been studied for its potential in skin whitening by inhibiting tyrosinase, an enzyme involved in melanin production, as well as its ability to reduce hyperpigmentation. Additionally, research suggests it may have protective effects against cardiovascular diseases and certain cancers, highlighting its potential as a versatile therapeutic agent.
| Catalog Number | R015032 |
| CAS Number | 59870-68-7 |
| Synonyms | (R)-4-(3,4-Dihydro-8,8-dimethyl-2H,8H-benzo[1,2-b:3,4-b’]dipyran-3-yl)-1,3-Benzenediol; 2H,8H-Benzo[1,2-b:3,4-b’]dipyran-1,3-benzenediol deriv.; |
| Molecular Formula | C20H20O4 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 4-[(3R)-8,8-dimethyl-3,4-dihydro-2H-pyrano[2,3-f]chromen-3-yl]benzene-1,3-diol |
| InChI | InChI=1S/C20H20O4/c1-20(2)8-7-16-18(24-20)6-3-12-9-13(11-23-19(12)16)15-5-4-14(21)10-17(15)22/h3-8,10,13,21-22H,9,11H2,1-2H3/t13-/m0/s1 |
| InChIKey | LBQIJVLKGVZRIW-ZDUSSCGKSA-N |
| SMILES | CC1(C=CC2=C(O1)C=CC3=C2OC[C@H](C3)C4=C(C=C(C=C4)O)O)C |
