For research use only. Not for therapeutic Use.
GLP-1R agonist 2(Cat No.:I012612)is a synthetic compound designed to activate the glucagon-like peptide-1 receptor (GLP-1R), a receptor involved in regulating insulin secretion, glucose metabolism, and appetite. By stimulating GLP-1R, the agonist enhances insulin release in response to meals, promotes satiety, and inhibits glucagon release, which helps lower blood glucose levels. GLP-1R agonists, like GLP-1R agonist 2, are being studied for their potential use in treating type 2 diabetes, obesity, and metabolic disorders. Clinical trials are ongoing to assess their efficacy, safety, and long-term benefits for managing these conditions.
CAS Number | 281209-71-0 |
Synonyms | N-tert-butyl-6,7-dichloro-3-methylsulfonylquinoxalin-2-amine |
Molecular Formula | C13H15Cl2N3O2S |
Purity | ≥95% |
IUPAC Name | N-tert-butyl-6,7-dichloro-3-methylsulfonylquinoxalin-2-amine |
InChI | InChI=1S/C13H15Cl2N3O2S/c1-13(2,3)18-11-12(21(4,19)20)17-10-6-8(15)7(14)5-9(10)16-11/h5-6H,1-4H3,(H,16,18) |
InChIKey | GNZCSGYHILBXLL-UHFFFAOYSA-N |
SMILES | CC(C)(C)NC1=NC2=CC(=C(C=C2N=C1S(=O)(=O)C)Cl)Cl |