For research use only. Not for therapeutic Use.
GLPG0259（Cat No.:I028088）is a small molecule inhibitor developed by Galapagos NV, designed to target specific enzymes or receptors involved in the inflammatory response and autoimmune diseases. It primarily works by inhibiting a particular signaling pathway that contributes to chronic inflammation and tissue damage. GLPG0259 has been studied for its potential use in treating diseases like rheumatoid arthritis and other autoimmune disorders. Early research indicates that it may reduce inflammatory markers and improve clinical outcomes. However, further clinical trials are required to confirm its safety, efficacy, and long-term potential for therapeutic use in these conditions.
| CAS Number | 959754-85-9 |
| Synonyms | 4-[8-[4-(4-tert-butylpiperazin-1-yl)anilino]-[1,2,4]triazolo[1,5-a]pyrazin-5-yl]furan-2-carboxamide |
| Molecular Formula | C24H28N8O2 |
| Purity | ≥95% |
| IUPAC Name | 4-[8-[4-(4-tert-butylpiperazin-1-yl)anilino]-[1,2,4]triazolo[1,5-a]pyrazin-5-yl]furan-2-carboxamide |
| InChI | InChI=1S/C24H28N8O2/c1-24(2,3)31-10-8-30(9-11-31)18-6-4-17(5-7-18)29-22-23-27-15-28-32(23)19(13-26-22)16-12-20(21(25)33)34-14-16/h4-7,12-15H,8-11H2,1-3H3,(H2,25,33)(H,26,29) |
| InChIKey | DLGZLIXYVSQGOX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N1CCN(CC1)C2=CC=C(C=C2)NC3=NC=C(N4C3=NC=N4)C5=COC(=C5)C(=O)N |
