For research use only. Not for therapeutic Use.
(Glu2)-TRH(Cat No.:I042261)is a modified form of thyrotropin-releasing hormone (TRH), a peptide that plays a key role in the regulation of thyroid hormone secretion and the hypothalamic-pituitary-thyroid axis. The modification involves replacing the second amino acid, typically proline, with glutamic acid (Glu2). This alteration can impact the peptide’s activity, receptor binding, and biological effects. (Glu2)-TRH is studied for its potential in modulating thyroid function and its use in research on neuroendocrine signaling, as well as exploring its therapeutic applications in conditions like hypothyroidism and metabolic disorders.
CAS Number | 85541-78-2 |
Synonyms | (4S)-5-[(2S)-2-carbamoylpyrrolidin-1-yl]-5-oxo-4-[[(2S)-5-oxopyrrolidine-2-carbonyl]amino]pentanoic acid |
Molecular Formula | C15H22N4O6 |
Purity | ≥95% |
IUPAC Name | (4S)-5-[(2S)-2-carbamoylpyrrolidin-1-yl]-5-oxo-4-[[(2S)-5-oxopyrrolidine-2-carbonyl]amino]pentanoic acid |
InChI | InChI=1S/C15H22N4O6/c16-13(23)10-2-1-7-19(10)15(25)9(4-6-12(21)22)18-14(24)8-3-5-11(20)17-8/h8-10H,1-7H2,(H2,16,23)(H,17,20)(H,18,24)(H,21,22)/t8-,9-,10-/m0/s1 |
InChIKey | HYZBGWLLSXSYLX-GUBZILKMSA-N |
SMILES | C1C[C@H](N(C1)C(=O)[C@H](CCC(=O)O)NC(=O)[C@@H]2CCC(=O)N2)C(=O)N |