For research use only. Not for therapeutic Use.
Gluconate Sodium(CAT: I013824) is a sodium salt of gluconic acid, widely used as a chelating agent and pH adjuster in various research applications. It effectively binds metal ions, such as calcium and magnesium, making it particularly valuable in biochemical and pharmaceutical research for stabilizing solutions, preventing precipitation, and enhancing solubility. Additionally, it is used in studies related to mineral metabolism and electrolyte balance. Gluconate Sodium is a versatile compound, essential for advancing research in enzymology, metabolic processes, and drug formulation development.
CAS Number | 527-07-1 |
Molecular Formula | C₆H₁₁NaO₇ |
Purity | ≥95% |
Target | Others |
Solubility | H2O: ≥ 100 mg/mL |
IUPAC Name | sodium;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate |
InChI | InChI=1S/C6H12O7.Na/c7-1-2(8)3(9)4(10)5(11)6(12)13;/h2-5,7-11H,1H2,(H,12,13);/q;+1/p-1/t2-,3-,4+,5-;/m1./s1 |
InChIKey | UPMFZISCCZSDND-JJKGCWMISA-M |
SMILES | C([C@H]([C@H]([C@@H]([C@H](C(=O)[O-])O)O)O)O)O.[Na+] |