For research use only. Not for therapeutic Use.
Gluconic acid, monoammonium salt is a bioactive chemical.
| Catalog Number | I028095 |
| CAS Number | 2554-04-3 |
| Synonyms | Gluconic acid, monoammonium salt |
| Molecular Formula | C6H15NO7 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | Gluconic acid, monoammonium salt |
| InChI | InChI=1S/C6H12O7.H3N/c7-1-2(8)3(9)4(10)5(11)6(12)13;/h2-5,7-11H,1H2,(H,12,13);1H3/t2-,3-,4+,5-;/m1./s1 |
| InChIKey | XLCNHLXQKYRGKZ-JJKGCWMISA-N |
| SMILES | O[C@H]([C@H]([C@@H]([C@@H](CO)O)O)O)C([O-])=O.[NH4+] |
