For research use only. Not for therapeutic Use.
Glucose-malemide(CAT: I040877) is a conjugate of glucose and maleimide, commonly used in biochemical research. The maleimide group is reactive and can form covalent bonds with thiol groups, enabling the selective labeling of biomolecules or cells. This glucose-malemide conjugate is useful for targeting glucose transporters or for studies involving cellular glucose uptake mechanisms, as glucose is a key molecule for cellular metabolism. It can be used in research on diabetes, metabolic disorders, and cell biology, particularly in studies focused on glucose metabolism, receptor targeting, and drug delivery systems, making it relevant for Metabolic Disease Research.
| CAS Number | 2093979-63-4 |
| Synonyms | 4-[(2,5-dioxopyrrol-1-yl)methyl]-N-[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]cyclohexane-1-carboxamide |
| Molecular Formula | C18H26N2O8 |
| Purity | ≥95% |
| IUPAC Name | 4-[(2,5-dioxopyrrol-1-yl)methyl]-N-[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]cyclohexane-1-carboxamide |
| InChI | InChI=1S/C18H26N2O8/c21-8-12(16(26)17(27)13(23)9-22)19-18(28)11-3-1-10(2-4-11)7-20-14(24)5-6-15(20)25/h5-6,8,10-13,16-17,22-23,26-27H,1-4,7,9H2,(H,19,28)/t10?,11?,12-,13+,16+,17+/m0/s1 |
| InChIKey | WGCWWZIZUDJXPC-WYDHFJRPSA-N |
| SMILES | C1CC(CCC1CN2C(=O)C=CC2=O)C(=O)N[C@@H](C=O)[C@H]([C@@H]([C@@H](CO)O)O) |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
