For research use only. Not for therapeutic Use.
GluR6 antagonist-1 is a benzothiophene derivative, acting as a GluR6 antagonist. GluR6 antagonist-1 can be used for researching acute and chronic neurological disorders[1].
| Catalog Number | I043522 |
| CAS Number | 323176-64-3 |
| Synonyms | 3-chloro-N-(pyridin-3-ylmethyl)-1-benzothiophene-2-carboxamide |
| Molecular Formula | C15H11ClN2OS |
| Purity | ≥95% |
| InChI | InChI=1S/C15H11ClN2OS/c16-13-11-5-1-2-6-12(11)20-14(13)15(19)18-9-10-4-3-7-17-8-10/h1-8H,9H2,(H,18,19) |
| InChIKey | FLKPRONUHHJNKH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(S2)C(=O)NCC3=CN=CC=C3)Cl |
| Reference | [1]. BAKER STEPHEN RICHARD, et al. BENZOTHIOPHENE DERIVATIVES. WO2001007431 A2 (example 20) |
