For research use only. Not for therapeutic Use.
GluR6 antagonist-1（Cat No.:I043522）is a compound designed to selectively inhibit the activity of the GluR6 receptor, a subtype of the AMPA glutamate receptor involved in excitatory neurotransmission in the brain. By blocking GluR6, this antagonist aims to modulate glutamate signaling, which is implicated in various neurological conditions such as epilepsy, neurodegenerative diseases, and chronic pain. The compound is under investigation for its potential therapeutic benefits in treating disorders related to excitotoxicity and abnormal glutamate activity. Research is ongoing to assess its safety, efficacy, and potential applications in central nervous system diseases.
| CAS Number | 323176-64-3 |
| Synonyms | 3-chloro-N-(pyridin-3-ylmethyl)-1-benzothiophene-2-carboxamide |
| Molecular Formula | C15H11ClN2OS |
| Purity | ≥95% |
| IUPAC Name | 3-chloro-N-(pyridin-3-ylmethyl)-1-benzothiophene-2-carboxamide |
| InChI | InChI=1S/C15H11ClN2OS/c16-13-11-5-1-2-6-12(11)20-14(13)15(19)18-9-10-4-3-7-17-8-10/h1-8H,9H2,(H,18,19) |
| InChIKey | FLKPRONUHHJNKH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(S2)C(=O)NCC3=CN=CC=C3)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
