For research use only. Not for therapeutic Use.
Glutaminase C-IN-1 (968) (CAT: I003099) stands out as an allosteric inhibitor specifically targeting Glutaminase C, an enzyme involved in glutamine metabolism. This inhibitor’s distinctive mechanism of action allows it to selectively inhibit the growth of cancer cells while leaving their normal cellular counterparts unaffected. By targeting the altered metabolism of cancer cells, Glutaminase C-IN-1 (968) offers potential avenues for developing innovative cancer therapies.
CAS Number | 311795-38-7 |
Synonyms | 5-[3-bromo-4-(dimethylamino)phenyl]-2,3,5,6-tetrahydro-2,2-dimethyl-benzo[a]phenanthridin-4(1H)-one |
Molecular Formula | C₂₇H₂₇BrN₂O |
Purity | ≥95% |
Target | Glutaminase |
Solubility | 10 mM in DMSO |
Storage | -20°C |
InChI | InChI=1S/C27H27BrN2O/c1-27(2)14-19-24-18-8-6-5-7-16(18)9-11-21(24)29-26(25(19)23(31)15-27)17-10-12-22(30(3)4)20(28)13-17/h5-13,26,29H,14-15H2,1-4H3 |
InChIKey | NVFRRJQWRZFDLM-UHFFFAOYSA-N |
SMILES | CC1(CC2=C(C(NC3=C2C4=CC=CC=C4C=C3)C5=CC(=C(C=C5)N(C)C)Br)C(=O)C1)C |
Reference | <p style=/line-height:25px/> </p> |