For research use only. Not for therapeutic Use.
Glutaric acid-d4(Cat No.:S000760) is a deuterium-labeled analog of glutaric acid, a naturally occurring organic compound in the dicarboxylic acid family. It has the chemical formula C5D4H2O4. This isotopically labeled substance is primarily used in scientific research to study metabolic pathways and chemical interactions involving glutaric acid. The four deuterium atoms replace the hydrogen atoms in the glutaric acid molecule, making it an ideal tracer for tracking and analyzing biochemical processes with enhanced accuracy. This compound is particularly valuable in mass spectrometry and NMR spectroscopy, providing clear, differentiated signals.
CAS Number | 19136-99-3 |
Molecular Formula | C5H4D4O4 |
Purity | ≥95% |
Target | Endogenous Metabolite |
IUPAC Name | 2,2,4,4-tetradeuteriopentanedioic acid |
InChI | InChI=1S/C5H8O4/c6-4(7)2-1-3-5(8)9/h1-3H2,(H,6,7)(H,8,9)/i2D2,3D2 |
InChIKey | JFCQEDHGNNZCLN-RRVWJQJTSA-N |
SMILES | C(CC(=O)O)CC(=O)O |