For research use only. Not for therapeutic Use.
Glutaric acid, monoammonium salt is a bioactive chemical.
| Catalog Number | I028108 |
| CAS Number | 57535-40-7 |
| Synonyms | Glutaric acid, monoammonium salt |
| Molecular Formula | C5H11NO4 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | Glutaric acid, monoammonium salt |
| InChI | InChI=1S/C5H8O4.H3N/c6-4(7)2-1-3-5(8)9;/h1-3H2,(H,6,7)(H,8,9);1H3 |
| InChIKey | GKGYMXPRDRXIIL-UHFFFAOYSA-N |
| SMILES | O=C([O-])CCCC(O)=O.[NH4+] |
