For research use only. Not for therapeutic Use.
Glutaric acid sodium salt(Cat No.:M052665), commonly referred to as sodium glutarate, is the sodium salt form of glutaric acid. This white, crystalline powder is highly soluble in water and exhibits properties typical of a salt, such as a high melting point and stability. Sodium glutarate is utilized in various industrial applications, including as a plasticizer and a building block in polymer production. It also serves as a bio-based chemical in green chemistry for producing eco-friendly solvents and as a buffer in biochemical research settings.
CAS Number | 13521-83-0 |
Molecular Formula | C5H6Na2O4 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | disodium;pentanedioate |
InChI | InChI=1S/C5H8O4.2Na/c6-4(7)2-1-3-5(8)9;;/h1-3H2,(H,6,7)(H,8,9);;/q;2*+1/p-2 |
InChIKey | ZUDYLZOBWIAUPC-UHFFFAOYSA-L |
SMILES | C(CC(=O)[O-])CC(=O)[O-].[Na+].[Na+] |