For research use only. Not for therapeutic Use.
Glutathione (Cat.No:A000043) is a crucial tripeptide composed of three amino acids: glutamate, cysteine, and glycine. It serves as a powerful antioxidant, protecting cells from damage caused by reactive oxygen species. Glutathione plays a vital role in detoxification processes, immune function, and maintaining cellular health.
CAS Number | 70-18-8 |
Synonyms | Isethion, Glutathion, Tathion |
Molecular Formula | C10H17N3O6S |
Purity | ≥95% |
Target | NF-κB |
Solubility | Soluble to 100 mM in sterile water |
Storage | Store at +4 ℃ |
IUPAC Name | (2S)-2-amino-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid |
InChI | 1S/C10H17N3O6S/c11-5(10(18)19)1-2-7(14)13-6(4-20)9(17)12-3-8(15)16/h5-6,20H,1-4,11H2,(H,12,17)(H,13,14)(H,15,16)(H,18,19)/t5-,6-/m0/s1 |
InChIKey | RWSXRVCMGQZWBV-GDVGLLTNSA-N |
SMILES | C(CC(=O)N[C@@H](CS)C(=O)NCC(=O)O)[C@@H](C(=O)O)N |