For research use only. Not for therapeutic Use.
Gly-Pro-Arg-Pro acetate（Cat No.:I028159）is a synthetic peptide composed of four amino acids: glycine (Gly), proline (Pro), arginine (Arg), and proline (Pro) again, with an acetate group attached. This peptide is often used in scientific research, particularly in studies of peptide interactions and signaling pathways. It can have biological activity related to the modulation of cellular processes, such as promoting wound healing or acting as a potential signaling molecule. The acetate salt form enhances its stability and solubility in aqueous solutions, making it useful in various laboratory applications.
| Catalog Number | I028159 |
| CAS Number | 67869-62-9 |
| Synonyms | Gly-Pro-Arg-Pro Acetate; GPRP; Gly-Pro-Arg-Pro Acetate salt; |
| Molecular Formula | C20H35N7O7 |
| Purity | 98% |
| Target | Integrin |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | acetic acid;(2S)-1-[(2S)-2-[[(2S)-1-(2-aminoacetyl)pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carboxylic acid |
| InChI | InChI=1S/C18H31N7O5.C2H4O2/c19-10-14(26)24-8-2-5-12(24)15(27)23-11(4-1-7-22-18(20)21)16(28)25-9-3-6-13(25)17(29)30;1-2(3)4/h11-13H,1-10,19H2,(H,23,27)(H,29,30)(H4,20,21,22);1H3,(H,3,4)/t11-,12-,13-;/m0./s1 |
| InChIKey | ZYTSTPIIKNCGRE-QKWXXBCPSA-N |
| SMILES | CC(=O)O.C1C[C@H](N(C1)C(=O)CN)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N2CCC[C@H]2C(=O)O |
| Reference | 1: Redlich H, Vickers J, Lösche W, Heptinstall S, Kehrel B, Spangenberg P. Formation of platelet-leukocyte conjugates in whole blood. Platelets. 1997;8(6):419-25. PubMed PMID: 16793677. |
