For research use only. Not for therapeutic Use.
Gly-Pro-Glu（Cat No.:I006987）is a tripeptide composed of glycine, proline, and glutamic acid. It is commonly used in biochemical and pharmacological research to study the effects of peptide sequences on cellular processes, including protein synthesis, enzymatic activity, and cell signaling. The combination of amino acids in Gly-Pro-Glu is of interest due to its potential to influence protein folding, structure, and function. It has applications in exploring mechanisms of peptide interactions, studying metabolic pathways, and investigating the role of specific amino acid sequences in physiological functions like neurotransmission and cellular metabolism.
| CAS Number | 32302-76-4 |
| Synonyms | (2S)-2-[[(2S)-1-(2-aminoacetyl)pyrrolidine-2-carbonyl]amino]pentanedioic acid |
| Molecular Formula | C12H19N3O6 |
| Purity | ≥95% |
| IUPAC Name | (2S)-2-[[(2S)-1-(2-aminoacetyl)pyrrolidine-2-carbonyl]amino]pentanedioic acid |
| InChI | InChI=1S/C12H19N3O6/c13-6-9(16)15-5-1-2-8(15)11(19)14-7(12(20)21)3-4-10(17)18/h7-8H,1-6,13H2,(H,14,19)(H,17,18)(H,20,21)/t7-,8-/m0/s1 |
| InChIKey | JJGBXTYGTKWGAT-YUMQZZPRSA-N |
| SMILES | C1C[C@H](N(C1)C(=O)CN)C(=O)N[C@@H](CCC(=O)O)C(=O)O |
