For research use only. Not for therapeutic Use.
Glycerol-d5(Cat No.:R048384) is a deuterated version of glycerol, where five hydrogen atoms are replaced with deuterium. This isotopic modification significantly enhances the molecule’s stability and resistance to exchange reactions, making it highly valuable for spectroscopic studies such as NMR (Nuclear Magnetic Resonance). Glycerol is a key compound in biological systems and industrial applications, serving as a backbone for triglycerides and a solvent or sweetener in pharmaceuticals and food products. Glycerol-d5 provides critical insights into metabolic pathways and molecular interactions, aiding in biochemical research and the development of pharmaceutical formulations.
Catalog Number | R048384 |
CAS Number | 62502-71-0 |
Synonyms | 1,2,3-Propanetriol-d5; 1,3-Dihydroxy-2-propanol-d5; Propanetriol-d5; 1,2,3-Propane-1,1,2,3,3-d5-triol; 1,2,3-Trihydroxypropane-d5; Bulbold-d5; Cognis G-d5; Cristal-d5; DG Glycerin-d5; E 422-d5; Emery 916-d5; Glycerin-d5; Glycerin DG-d5; Glycerine-d5; |
Molecular Formula | C3H8O3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1,1,2,3,3-pentadeuteriopropane-1,2,3-triol |
InChI | InChI=1S/C3H8O3/c4-1-3(6)2-5/h3-6H,1-2H2/i1D2,2D2,3D |
InChIKey | PEDCQBHIVMGVHV-UXXIZXEISA-N |
SMILES | [2H]C([2H])(C([2H])(C([2H])([2H])O)O)O |