For research use only. Not for therapeutic Use.
Glycerol（Cat No.:R048383）, is a simple polyol compound, also known as glycerin or glycerine. It is a colorless, odorless, and sweet-tasting liquid that is widely used in various industries. Glycerol has numerous applications, including as a moisturizing agent in cosmetics and personal care products, a humectant in the food industry to retain moisture and sweetness in products like baked goods and confections, and as a solvent and lubricant in pharmaceuticals and industrial processes. It also plays a role in the production of biofuels, pharmaceuticals, and explosives. Glycerol’s versatility and safety make it a valuable and ubiquitous compound in modern manufacturing and consumer products.
| Catalog Number | R048383 |
| CAS Number | 56-81-5 |
| Synonyms | 1,2,3-Propanetriol; 1,3-dihydroxy-2-propanol; Propanetriol; 1,2,3-Trihydroxypropane; Bulbold; Cognis G; Cristal; DG; DG Glycerin; E 422; Emery 916; GL 300; Glycerin; Glycerin DG; Glycerine; Glyceritol; Glycyl Alcohol; Glyrol; Glysanin; IFP; M 314429; |
| Molecular Formula | C₃H₈O₃ |
| Purity | ≥95% |
| Target | Endogenous Metabolite |
| Storage | -20°C |
| IUPAC Name | propane-1,2,3-triol |
| InChI | InChI=1S/C3H8O3/c4-1-3(6)2-5/h3-6H,1-2H2 |
| InChIKey | PEDCQBHIVMGVHV-UHFFFAOYSA-N |
| SMILES | C(C(CO)O)O |
