For research use only. Not for therapeutic Use.
Glycerol Triformate (CAT: R016465) is a frequently encountered small-molecule compound in organic synthesis and chemical industries. As a member of the triglyceride family, it is typically present in animal and vegetable fats. This compound is exclusively intended for scientific research, medical research and development, and chemical production purposes.
CAS Number | 32765-69-8 |
Synonyms | Triformin; 1,2,3-Propanetriol, 1,2,3-Triformate; 1,2,3-Propanetriol, Triformate |
Molecular Formula | C6H8O6 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2,3-diformyloxypropyl formate |
InChI | InChI=1S/C6H8O6/c7-3-10-1-6(12-5-9)2-11-4-8/h3-6H,1-2H2 |
InChIKey | UFTFJSFQGQCHQW-UHFFFAOYSA-N |
SMILES | C(C(COC=O)OC=O)OC=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |