For research use only. Not for therapeutic Use.
Glycerol Triformate (CAT: R016465) is a frequently encountered small-molecule compound in organic synthesis and chemical industries. As a member of the triglyceride family, it is typically present in animal and vegetable fats. This compound is exclusively intended for scientific research, medical research and development, and chemical production purposes.
| Catalog Number | R016465 |
| CAS Number | 32765-69-8 |
| Synonyms | Triformin; 1,2,3-Propanetriol, 1,2,3-Triformate; 1,2,3-Propanetriol, Triformate |
| Molecular Formula | C6H8O6 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2,3-diformyloxypropyl formate |
| InChI | InChI=1S/C6H8O6/c7-3-10-1-6(12-5-9)2-11-4-8/h3-6H,1-2H2 |
| InChIKey | UFTFJSFQGQCHQW-UHFFFAOYSA-N |
| SMILES | C(C(COC=O)OC=O)OC=O |
