For research use only. Not for therapeutic Use.
Glycerol triglycidyl ether (Cat No.:M059686) is a chemical compound derived from glycerol and characterized by the presence of three epoxy groups, making it highly reactive. It is a viscous, colorless liquid used primarily as a reactive diluent in epoxy resins. GTE enhances the mechanical properties and thermal stability of cured resins and finds applications in coatings, adhesives, and composites. Its low viscosity improves the handling and application of epoxy formulations. GTE also improves the adhesion properties and chemical resistance of the final product, making it valuable in industrial and construction settings.
| Catalog Number | M059686 |
| CAS Number | 13236-02-7 |
| Molecular Formula | C12H20O6 |
| Purity | ≥95% |
| Storage | Desiccate at RT |
| IUPAC Name | 2-[1,3-bis(oxiran-2-ylmethoxy)propan-2-yloxymethyl]oxirane |
| InChI | InChI=1S/C12H20O6/c1(13-3-10-5-16-10)9(15-7-12-8-18-12)2-14-4-11-6-17-11/h9-12H,1-8H2 |
| InChIKey | SYEWHONLFGZGLK-UHFFFAOYSA-N |
| SMILES | C1C(O1)COCC(COCC2CO2)OCC3CO3 |
