For research use only. Not for therapeutic Use.
Glyceryl Monoricinoleate（Cat No.:M049686）, is an ester compound derived from glycerol and ricinoleic acid, which is a monounsaturated fatty acid found in castor oil. This ingredient has various applications in cosmetics and pharmaceuticals. It serves as an emulsifier, stabilizer, and surfactant, helping to blend oil and water-based components in formulations and improve their texture and consistency. Additionally, glyceryl monoricinoleate can function as a skin conditioning agent in skincare products due to its moisturizing properties. Its versatility and compatibility with other ingredients make it a valuable component in the production of creams, lotions, and topical formulations.
| Catalog Number | M049686 |
| CAS Number | 1323-38-2 |
| Synonyms | 2,3-dihydroxypropyl 12-hydroxyoctadec-9-enoate |
| Molecular Formula | C21H40O5 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2,3-dihydroxypropyl 12-hydroxyoctadec-9-enoate |
| InChI | InChI=1S/C21H40O5/c1-2-3-4-11-14-19(23)15-12-9-7-5-6-8-10-13-16-21(25)26-18-20(24)17-22/h9,12,19-20,22-24H,2-8,10-11,13-18H2,1H3 |
| InChIKey | HDIFHQMREAYYJW-UHFFFAOYSA-N |
| SMILES | CCCCCCC(CC=CCCCCCCCC(=O)OCC(CO)O)O |
