For research use only. Not for therapeutic Use.
Glycidamide(CAT: R002684) is a high-purity organic compound featuring an epoxide ring and an amide functional group. It is a key intermediate in chemical research, particularly in studying the metabolism of acrylamide, as it is a major reactive metabolite formed in vivo. Glycidamide is widely used in toxicology research to investigate its role in DNA adduct formation and mutagenicity. Additionally, it serves as a valuable reagent in organic synthesis for the preparation of specialized compounds. Its unique reactivity and structure make Glycidamide essential for advancing studies in biochemical, pharmaceutical, and fine chemical applications.
| Catalog Number | R002684 |
| CAS Number | 5694-00-8 |
| Synonyms | Oxiranecarboxamide, Glycidic Acid Amide |
| Molecular Formula | C3H5NO2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | oxirane-2-carboxamide |
| InChI | InChI=1S/C3H5NO2/c4-3(5)2-1-6-2/h2H,1H2,(H2,4,5) |
| InChIKey | FMAZQSYXRGRESX-UHFFFAOYSA-N |
| SMILES | C1C(O1)C(=O)N |
