For research use only. Not for therapeutic Use.
Glycidyl acrylate(Cat No.:M070530) is a chemical compound used in various industrial applications, particularly in the production of polymers and resins. With its reactive epoxide group and acrylic functionality, it serves as a crucial building block in the synthesis of adhesives, coatings, and sealants. Its versatility extends to coatings for metal, concrete, and plastics, enhancing their durability and adhesion properties. Additionally, glycidyl acrylate finds utility in the manufacture of UV-curable materials, enabling rapid curing processes in coatings and printing inks.
CAS Number | 106-90-1 |
Molecular Formula | C6H8O3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | oxiran-2-ylmethyl prop-2-enoate |
InChI | InChI=1S/C6H8O3/c1-2-6(7)9-4-5-3-8-5/h2,5H,1,3-4H2 |
InChIKey | RPQRDASANLAFCM-UHFFFAOYSA-N |
SMILES | C=CC(=O)OCC1CO1 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |