For research use only, not for therapeutic use.
Glycine-1-13C-15N is a high-purity, isotopically labeled amino acid essential for advanced biochemical and metabolic research. This compound, featuring carbon-13 and nitrogen-15 isotopes, is crucial for studying protein synthesis, metabolic pathways, and isotope tracing. Its stable isotope labeling ensures precise and reliable results in mass spectrometry and NMR spectroscopy. Ideal for cutting-edge research in proteomics, enzymology, and analytical chemistry, Glycine-1-13C-15N enhances the accuracy of experimental data, supporting advancements in scientific investigations and metabolic studies.
| Catalog Number | M020053 |
| CAS Number | 112898-03-0 |
| Molecular Formula | C2H5NO2 |
| Purity | ≥95% |
| Storage | Store at RT |
| IUPAC Name | 2-azanylacetic acid |
| InChI | InChI=1S/C2H5NO2/c3-1-2(4)5/h1,3H2,(H,4,5)/i2+1,3+1 |
| InChIKey | DHMQDGOQFOQNFH-SUEIGJEOSA-N |
| SMILES | C(C(=O)O)N |
