Glycine-13C is a high-purity isotopically labeled compound essential for advanced research in biochemistry, metabolic studies, and pharmaceutical development. This version of glycine, featuring a carbon-13 atom, is crucial for tracing metabolic pathways, studying protein synthesis, and analyzing nucleic acid metabolism. Its stable isotope labeling ensures precise and reliable analytical results, providing enhanced stability and consistency in various experimental setups. Ideal for metabolic flux analysis, structural biology, and drug development, Glycine-13C integrates seamlessly into existing protocols, offering a robust and cost-effective solution for high-precision scientific investigations.
| Catalog Number | R016597 |
| CAS Number | 20220-62-6 |
| Synonyms | 2-Aminoacetic Acid-13C; Aciport-13C; Aminoethanoic Acid-13C; Glicoamin-13C; Glycocoll-13C; Glycolixir-13C; Glycosthene-13C; Gyn-Hydralin-13C; NSC 25936-13C; NSC 2916-13C; NSC 54188-13C; Padil-13C; |
| Molecular Formula | C2H5NO2 |
| Purity | 95% |
| Storage | Room temperature |
| IUPAC Name | 2-aminoacetic acid |
| InChI | InChI=1S/C2H5NO2/c3-1-2(4)5/h1,3H2,(H,4,5)/i1+1 |
| InChIKey | DHMQDGOQFOQNFH-OUBTZVSYSA-N |
| SMILES | [13CH2](C(=O)O)N |
