For research use only. Not for therapeutic Use.
Glycine-13C2(Cat No.:C000375) is an isotopically labeled variant of the amino acid glycine. Glycine is considered a non-essential amino acid, meaning that it can be synthesized by the human body. It serves various roles in biological systems, including acting as an inhibitory neurotransmitter in the spinal cord and functioning as an allosteric regulator of NMDA receptors in the brain. Isotope labeling, such as introducing carbon-13 isotopes, allows researchers to track the movement and metabolism of molecules within biological systems.
| Catalog Number | C000375 |
| CAS Number | 67836-01-5 |
| Synonyms | 2-Aminoacetic-13C2 Acid; Aciport-13C2; Aminoethanoic-13C2 Acid; Glicoamin-13C2; Glycocoll-13C2; Glycolixir-13C2; Glycosthene-13C2; Gyn-Hydralin-13C2; H 1-13C2; NSC 25936-13C2; NSC 2916-13C2; NSC 54188-13C2; Padil-13C2; |
| Molecular Formula | ¹³C₂H₅NO₂ |
| Purity | ≥95% |
| Solubility | Acetonitrile (Slightly), Methanol (Slightly), Water (Slightly) |
| Appearance | White to Off-White Solid |
| Storage | 4°C |
| IUPAC Name | 2-aminoacetic acid |
| InChI | InChI=1S/C2H5NO2/c3-1-2(4)5/h1,3H2,(H,4,5)/i1+1,2+1 |
| InChIKey | DHMQDGOQFOQNFH-ZDOIIHCHSA-N |
| SMILES | [13CH2]([13C](=O)O)N |
