Glycine-13C2,15N（Cat No.:S000613） is a stable isotope-labeled form of glycine, where two carbon atoms are replaced with carbon-13 (13C) and the nitrogen atom is substituted with nitrogen-15 (15N). This specific labeling enhances the detection and quantification of glycine in biological and chemical studies using techniques like mass spectrometry and nuclear magnetic resonance (NMR) spectroscopy. Glycine-13C2,15N is particularly useful for researching glycine’s role in protein synthesis, neurotransmission, and detoxification processes. By tracing its metabolic pathways more precisely, researchers can gain deeper insights into glycine’s function in various physiological and pathological conditions.
| Catalog Number | S000613 |
| CAS Number | 211057-02-2 |
| Molecular Formula | 13C2H515NO2 |
| Purity | ≥95% |
| IUPAC Name | 2-(15N)azanylacetic acid |
| InChI | InChI=1S/C2H5NO2/c3-1-2(4)5/h1,3H2,(H,4,5)/i1+1,2+1,3+1 |
| InChIKey | DHMQDGOQFOQNFH-VMIGTVKRSA-N |
| SMILES | C(C(=O)O)N |
