For research use only. Not for therapeutic Use.
Glycocholic Acid Hydrate (Cat No.:C001111) is a compound derived from cholic acid and glycine, belonging to the class of bile acids. It plays a crucial role in the digestion and absorption of dietary fats. The presence of a hydrate indicates the presence of water molecules in its structure. Glycocholic Acid Hydrate may find applications in pharmaceutical research and as a reference compound in analytical studies.
| Catalog Number | C001111 |
| CAS Number | 1192657-83-2 |
| Synonyms | N-[(3α,5β,7α,12α)-3,7,12-Τrihydroxy-24-oxocholan-24-yl]glycine Hydrate; |
| Molecular Formula | C₂₆H₄₃NO₆ x[H₂O] |
| Purity | ≥95% |
| Solubility | DMSO (Slightly), Ethanol (Slightly), Methanol (Slightly) |
| Appearance | White to Off-White Solid |
| Storage | 4°C, Hygroscopic |
| IUPAC Name | 2-[[(4R)-4-[(3R,5S,7R,8R,9S,10S,12S,13R,14S,17R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]amino]acetic acid;hydrate |
| InChI | InChI=1S/C26H43NO6.H2O/c1-14(4-7-22(31)27-13-23(32)33)17-5-6-18-24-19(12-21(30)26(17,18)3)25(2)9-8-16(28)10-15(25)11-20(24)29;/h14-21,24,28-30H,4-13H2,1-3H3,(H,27,31)(H,32,33);1H2/t14-,15+,16-,17-,18+,19+,20-,21+,24+,25+,26-;/m1./s1 |
| InChIKey | WDKPRHOCWKLQPK-ZUHYDKSRSA-N |
| SMILES | CC(CCC(=O)NCC(=O)O)C1CCC2C1(C(CC3C2C(CC4C3(CCC(C4)O)C)O)O)C.O |
| Reference | Ho, R., et al.: J. Biol. Chem., 279, 7213 (2004), |
