Glycocyamine-15N,13C2 is a high-purity isotopically labeled compound essential for advanced pharmaceutical and biochemical research. This version of Glycocyamine features nitrogen-15 and two carbon-13 atoms, making it crucial for studies involving amino acid metabolism, creatine biosynthesis, and metabolic pathway analysis. Its stable isotope labeling ensures precise and reliable analytical results. With enhanced stability and consistency, it is suitable for various experimental setups. Ideal for metabolic research and drug development, Glycocyamine-15N,13C2 integrates seamlessly into existing protocols, offering a robust and cost-effective solution for high-precision scientific investigations.
Catalog Number | S000958 |
CAS Number | 2483829-93-0 |
Molecular Formula | C13C2H7N215NO2 |
Purity | 95% |
IUPAC Name | 2-(diaminomethylideneamino)acetic acid |
InChI | InChI=1S/C3H7N3O2/c4-3(5)6-1-2(7)8/h1H2,(H,7,8)(H4,4,5,6)/i1+1,2+1,6+1 |
InChIKey | BPMFZUMJYQTVII-LQAOFMTQSA-N |
SMILES | [13CH2]([13C](=O)O)[15N]=C(N)N |