Glycocyamine-15N,13C2 is a high-purity isotopically labeled compound essential for advanced pharmaceutical and biochemical research. This version of Glycocyamine, featuring one nitrogen-15 atom and two carbon-13 atoms, is crucial for studies involving creatine biosynthesis, metabolic pathway analysis, and nitrogen metabolism. Its stable isotope labeling ensures precise and reliable analytical results. With enhanced stability and consistency, it is suitable for various experimental setups. Ideal for biochemistry research and drug development, Glycocyamine-15N,13C2 integrates seamlessly into existing protocols, offering a robust and cost-effective solution for high-precision scientific investigations.
Catalog Number | S000960 |
CAS Number | 2483829-93-0 |
Molecular Formula | C13C2H7N215NO2 |
Purity | 95% |
IUPAC Name | 2-(diaminomethylideneamino)acetic acid |
InChI | InChI=1S/C3H7N3O2/c4-3(5)6-1-2(7)8/h1H2,(H,7,8)(H4,4,5,6)/i1+1,2+1,6+1 |
InChIKey | BPMFZUMJYQTVII-LQAOFMTQSA-N |
SMILES | [13CH2]([13C](=O)O)[15N]=C(N)N |