For research use only. Not for therapeutic Use.
Glycol Chitosan(CAT: R018465) is a water-soluble derivative of chitosan, a natural biopolymer derived from the shells of crustaceans. By introducing glycol groups, this modified chitosan gains enhanced solubility in water, making it more versatile for biomedical and pharmaceutical applications. Glycol Chitosan is widely used as a drug delivery carrier, particularly in the development of nanoparticles and hydrogels, due to its biocompatibility, biodegradability, and ability to encapsulate a wide range of therapeutic agents. It also serves as a stabilizer and thickening agent in formulations, providing controlled release properties and improving the stability of active ingredients. Additionally, Glycol Chitosan is explored for its potential in tissue engineering, wound healing, and as a platform for gene delivery systems, owing to its ability to interact with biological tissues and its low toxicity.
CAS Number | 123938-86-3 |
Synonyms | 100D-VL; Amidan; Armour-Zen; BC 10; BC 10 (polysaccharide); Batch LO 7319CsU; Biochemica; Biochikol; Biochikol 020PC; Biopolymer L 112; C 3646; C 60M; CG 10; CG 110; CTA 1 Lactic Acid; CTA 4; Cerosan 5000; ChiSys; Chicol; Chiloclear; Chimarin; Chiros |
Molecular Formula | C24H47N3O16 |
Purity | 85% |
Documentation | |
Target | Bacterial |
Storage | -20°C |
IUPAC Name | (3S,4S,6S)-5-amino-6-[(3R,4S,6S)-5-amino-6-[(3R,4S,6R)-5-amino-4,6-dihydroxy-2-(2-hydroxyethoxymethyl)oxan-3-yl]oxy-4-hydroxy-2-(2-hydroxyethoxymethyl)oxan-3-yl]oxy-2-(2-hydroxyethoxymethyl)oxane-3,4-diol |
InChI | InChI=1S/C24H47N3O16/c25-13-18(33)20(11(39-22(13)35)8-37-5-2-29)42-24-15(27)19(34)21(12(41-24)9-38-6-3-30)43-23-14(26)17(32)16(31)10(40-23)7-36-4-1-28/h10-24,28-35H,1-9,25-27H2/t10?,11?,12?,13?,14?,15?,16-,17+,18+,19+,20+,21+,22-,23+,24+/m1/s1 |
InChIKey | RKEUQJJGKWLRQI-PGHSOFRXSA-N |
SMILES | C1[C@@H]([C@H]([C@@H]([C@H]([C@@H]1O[C@@H]2[C@H](C[C@H]([C@@H]([C@H]2O)N)O[C@@H]3[C@H](O[C@H]([C@@H]([C@H]3O)N)O)COCCO)COCCO)N)O)O)COCCO.N |